C15H19N3S2 — CID 8679090
(3S)-3-(1,3-benzothiazol-2-yl)-N-ethylpiperidine-1-carbothioamide (PubChem CID 8679090) has the molecular formula C15H19N3S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is (3S)-3-(1,3-benzothiazol-2-yl)-N-ethylpiperidine-1-carbothioamide.
| Compound Name | (3S)-3-(1,3-benzothiazol-2-yl)-N-ethylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 8679090 |
| Molecular Formula | C15H19N3S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | (3S)-3-(1,3-benzothiazol-2-yl)-N-ethylpiperidine-1-carbothioamide |
| SMILES | CCNC(=S)N1CCC[C@H](c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C15H19N3S2/c1-2-16-15(19)18-9-5-6-11(10-18)14-17-12-7-3-4-8-13(12)20-14/h3-4,7-8,11H,2,5-6,9-10H2,1H3,(H,16,19)/t11-/m0/s1 |
| InChIKey | BNFSQJULFPXTEY-NSHDSACASA-N |
| XLogP | 3.37 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|