C18H29N4OS+ — CID 2451088
3-[[4-(4-acetylphenyl)piperazine-1-carbothioyl]amino]propyl-dimethylazanium (PubChem CID 2451088) has the molecular formula C18H29N4OS+ and a molecular weight of 349.52 g/mol. Its IUPAC name is 3-[[4-(4-acetylphenyl)piperazine-1-carbothioyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[4-(4-acetylphenyl)piperazine-1-carbothioyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 2451088 |
| Molecular Formula | C18H29N4OS+ |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 3-[[4-(4-acetylphenyl)piperazine-1-carbothioyl]amino]propyl-dimethylazanium |
| SMILES | CC(=O)c1ccc(N2CCN(C(=S)NCCC[NH+](C)C)CC2)cc1 |
| InChI | InChI=1S/C18H28N4OS/c1-15(23)16-5-7-17(8-6-16)21-11-13-22(14-12-21)18(24)19-9-4-10-20(2)3/h5-8H,4,9-14H2,1-3H3,(H,19,24)/p+1 |
| InChIKey | LVYXOTFOSSEBLW-UHFFFAOYSA-O |
| XLogP | 0.42 |
| TPSA | 40.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|