C14H25N5S+2 — CID 8618751
dimethyl-[2-[(4-pyridin-1-ium-2-ylpiperazine-1-carbothioyl)amino]ethyl]azanium (PubChem CID 8618751) has the molecular formula C14H25N5S+2 and a molecular weight of 295.46 g/mol. Its IUPAC name is dimethyl-[2-[(4-pyridin-1-ium-2-ylpiperazine-1-carbothioyl)amino]ethyl]azanium.
| Compound Name | dimethyl-[2-[(4-pyridin-1-ium-2-ylpiperazine-1-carbothioyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 8618751 |
| Molecular Formula | C14H25N5S+2 |
| Molecular Weight | 295.46 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | dimethyl-[2-[(4-pyridin-1-ium-2-ylpiperazine-1-carbothioyl)amino]ethyl]azanium |
| SMILES | C[NH+](C)CCNC(=S)N1CCN(c2cccc[nH+]2)CC1 |
| InChI | InChI=1S/C14H23N5S/c1-17(2)8-7-16-14(20)19-11-9-18(10-12-19)13-5-3-4-6-15-13/h3-6H,7-12H2,1-2H3,(H,16,20)/p+2 |
| InChIKey | UQOCNDCPZQFHAD-UHFFFAOYSA-P |
| XLogP | -1.36 |
| TPSA | 37.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.46 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|