C15H24F3N5S+2 — CID 8789860
dimethyl-[2-[[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazine-1-carbothioyl]amino]ethyl]azanium (PubChem CID 8789860) has the molecular formula C15H24F3N5S+2 and a molecular weight of 363.45 g/mol. Its IUPAC name is dimethyl-[2-[[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazine-1-carbothioyl]amino]ethyl]azanium.
| Compound Name | dimethyl-[2-[[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazine-1-carbothioyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 8789860 |
| Molecular Formula | C15H24F3N5S+2 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | dimethyl-[2-[[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazine-1-carbothioyl]amino]ethyl]azanium |
| SMILES | C[NH+](C)CCNC(=S)N1CCN(c2ccc(C(F)(F)F)c[nH+]2)CC1 |
| InChI | InChI=1S/C15H22F3N5S/c1-21(2)6-5-19-14(24)23-9-7-22(8-10-23)13-4-3-12(11-20-13)15(16,17)18/h3-4,11H,5-10H2,1-2H3,(H,19,24)/p+2 |
| InChIKey | VXTDPNZATLFIJM-UHFFFAOYSA-P |
| XLogP | -0.34 |
| TPSA | 37.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|