C14H32N6S2+2 — CID 8668457
2-[[4-[2-(dimethylazaniumyl)ethylcarbamothioyl]piperazine-1-carbothioyl]amino]ethyl-dimethylazanium (PubChem CID 8668457) has the molecular formula C14H32N6S2+2 and a molecular weight of 348.59 g/mol. Its IUPAC name is 2-[[4-[2-(dimethylazaniumyl)ethylcarbamothioyl]piperazine-1-carbothioyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[4-[2-(dimethylazaniumyl)ethylcarbamothioyl]piperazine-1-carbothioyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 8668457 |
| Molecular Formula | C14H32N6S2+2 |
| Molecular Weight | 348.59 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2-[[4-[2-(dimethylazaniumyl)ethylcarbamothioyl]piperazine-1-carbothioyl]amino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=S)N1CCN(C(=S)NCC[NH+](C)C)CC1 |
| InChI | InChI=1S/C14H30N6S2/c1-17(2)7-5-15-13(21)19-9-11-20(12-10-19)14(22)16-6-8-18(3)4/h5-12H2,1-4H3,(H,15,21)(H,16,22)/p+2 |
| InChIKey | ZTOYZFACNBKIOA-UHFFFAOYSA-P |
| XLogP | -3.36 |
| TPSA | 39.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.59 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|