C16H17F3N3O+ — CID 9105881
2-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]phenol (PubChem CID 9105881) has the molecular formula C16H17F3N3O+ and a molecular weight of 324.33 g/mol. Its IUPAC name is 2-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]phenol.
| Compound Name | 2-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 9105881 |
| Molecular Formula | C16H17F3N3O+ |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]phenol |
| SMILES | Oc1ccccc1N1CCN(c2ccc(C(F)(F)F)c[nH+]2)CC1 |
| InChI | InChI=1S/C16H16F3N3O/c17-16(18,19)12-5-6-15(20-11-12)22-9-7-21(8-10-22)13-3-1-2-4-14(13)23/h1-6,11,23H,7-10H2/p+1 |
| InChIKey | KDSLGMBAWLXDPO-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 40.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |