C17H21F3N6S+2 — CID 7222296
1-methyl-3-[6-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]pyridin-1-ium-3-yl]thiourea (PubChem CID 7222296) has the molecular formula C17H21F3N6S+2 and a molecular weight of 398.46 g/mol. Its IUPAC name is 1-methyl-3-[6-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]pyridin-1-ium-3-yl]thiourea.
| Compound Name | 1-methyl-3-[6-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]pyridin-1-ium-3-yl]thiourea |
|---|---|
| PubChem CID | 7222296 |
| Molecular Formula | C17H21F3N6S+2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 1-methyl-3-[6-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]pyridin-1-ium-3-yl]thiourea |
| SMILES | CNC(=S)Nc1ccc(N2CCN(c3ccc(C(F)(F)F)c[nH+]3)CC2)[nH+]c1 |
| InChI | InChI=1S/C17H19F3N6S/c1-21-16(27)24-13-3-5-15(23-11-13)26-8-6-25(7-9-26)14-4-2-12(10-22-14)17(18,19)20/h2-5,10-11H,6-9H2,1H3,(H2,21,24,27)/p+2 |
| InChIKey | IUOUWXVONQXGMI-UHFFFAOYSA-P |
| XLogP | 1.58 |
| TPSA | 58.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|