C20H23F3N3O+ — CID 9208737
N-(4-ethylphenyl)-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide (PubChem CID 9208737) has the molecular formula C20H23F3N3O+ and a molecular weight of 378.42 g/mol. Its IUPAC name is N-(4-ethylphenyl)-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide.
| Compound Name | N-(4-ethylphenyl)-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9208737 |
| Molecular Formula | C20H23F3N3O+ |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-(4-ethylphenyl)-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide |
| SMILES | CCc1ccc(NC(=O)C2CCN(c3ccc(C(F)(F)F)c[nH+]3)CC2)cc1 |
| InChI | InChI=1S/C20H22F3N3O/c1-2-14-3-6-17(7-4-14)25-19(27)15-9-11-26(12-10-15)18-8-5-16(13-24-18)20(21,22)23/h3-8,13,15H,2,9-12H2,1H3,(H,25,27)/p+1 |
| InChIKey | ASUKBLKCYXOAPT-UHFFFAOYSA-O |
| XLogP | 3.94 |
| TPSA | 46.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |