C19H20F3N4O3+ — CID 9270705
N-(2-methyl-3-nitrophenyl)-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide (PubChem CID 9270705) has the molecular formula C19H20F3N4O3+ and a molecular weight of 409.39 g/mol. Its IUPAC name is N-(2-methyl-3-nitrophenyl)-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide.
| Compound Name | N-(2-methyl-3-nitrophenyl)-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9270705 |
| Molecular Formula | C19H20F3N4O3+ |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-(2-methyl-3-nitrophenyl)-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide |
| SMILES | Cc1c(NC(=O)C2CCN(c3ccc(C(F)(F)F)c[nH+]3)CC2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19F3N4O3/c1-12-15(3-2-4-16(12)26(28)29)24-18(27)13-7-9-25(10-8-13)17-6-5-14(11-23-17)19(20,21)22/h2-6,11,13H,7-10H2,1H3,(H,24,27)/p+1 |
| InChIKey | SXRXOAQCCFMKRK-UHFFFAOYSA-O |
| XLogP | 3.59 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|