C19H16F5N3O3 — CID 26681417
N-(2,4-difluorophenyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide (PubChem CID 26681417) has the molecular formula C19H16F5N3O3 and a molecular weight of 429.35 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26681417 |
| Molecular Formula | C19H16F5N3O3 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)C1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H16F5N3O3/c20-13-2-3-15(14(21)10-13)25-18(28)11-5-7-26(8-6-11)16-4-1-12(19(22,23)24)9-17(16)27(29)30/h1-4,9-11H,5-8H2,(H,25,28) |
| InChIKey | HXLGSTATGGNGHQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|