C20H19ClF3N3O4 — CID 26582381
N-(5-chloro-2-methoxyphenyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide (PubChem CID 26582381) has the molecular formula C20H19ClF3N3O4 and a molecular weight of 457.84 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26582381 |
| Molecular Formula | C20H19ClF3N3O4 |
| Molecular Weight | 457.84 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H19ClF3N3O4/c1-31-18-5-3-14(21)11-15(18)25-19(28)12-6-8-26(9-7-12)16-4-2-13(20(22,23)24)10-17(16)27(29)30/h2-5,10-12H,6-9H2,1H3,(H,25,28) |
| InChIKey | ZKEVNKMAGQNQGS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.84 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|