C20H20F3N3O3S — CID 27365291
N-(4-methylsulfanylphenyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide (PubChem CID 27365291) has the molecular formula C20H20F3N3O3S and a molecular weight of 439.46 g/mol. Its IUPAC name is N-(4-methylsulfanylphenyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide.
| Compound Name | N-(4-methylsulfanylphenyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 27365291 |
| Molecular Formula | C20H20F3N3O3S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-(4-methylsulfanylphenyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
| SMILES | CSc1ccc(NC(=O)C2CCN(c3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C20H20F3N3O3S/c1-30-16-5-3-15(4-6-16)24-19(27)13-8-10-25(11-9-13)17-7-2-14(20(21,22)23)12-18(17)26(28)29/h2-7,12-13H,8-11H2,1H3,(H,24,27) |
| InChIKey | CCNBDFLMZBRFKJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|