C21H22ClF3N4O4 — CID 46802088
N-(5-chloro-2-methoxyphenyl)-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide (PubChem CID 46802088) has the molecular formula C21H22ClF3N4O4 and a molecular weight of 486.88 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 46802088 |
| Molecular Formula | C21H22ClF3N4O4 |
| Molecular Weight | 486.88 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(C)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H22ClF3N4O4/c1-13(20(30)26-16-12-15(22)4-6-19(16)33-2)27-7-9-28(10-8-27)17-5-3-14(21(23,24)25)11-18(17)29(31)32/h3-6,11-13H,7-10H2,1-2H3,(H,26,30) |
| InChIKey | DZYZEGNGNYYMSB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.88 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|