C21H19F3N6O3 — CID 112827683
1-[2-nitro-4-(trifluoromethyl)phenyl]-N-[2-(triazol-1-yl)phenyl]piperidine-4-carboxamide (PubChem CID 112827683) has the molecular formula C21H19F3N6O3 and a molecular weight of 460.42 g/mol. Its IUPAC name is 1-[2-nitro-4-(trifluoromethyl)phenyl]-N-[2-(triazol-1-yl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-N-[2-(triazol-1-yl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 112827683 |
| Molecular Formula | C21H19F3N6O3 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-N-[2-(triazol-1-yl)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1-n1ccnn1)C1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H19F3N6O3/c22-21(23,24)15-5-6-18(19(13-15)30(32)33)28-10-7-14(8-11-28)20(31)26-16-3-1-2-4-17(16)29-12-9-25-27-29/h1-6,9,12-14H,7-8,10-11H2,(H,26,31) |
| InChIKey | YGSKFVOWJOZKFR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|