C18H21N4OS+ — CID 6926237
N-(4-acetylphenyl)-4-pyridin-1-ium-2-ylpiperazine-1-carbothioamide (PubChem CID 6926237) has the molecular formula C18H21N4OS+ and a molecular weight of 341.46 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-pyridin-1-ium-2-ylpiperazine-1-carbothioamide.
| Compound Name | N-(4-acetylphenyl)-4-pyridin-1-ium-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 6926237 |
| Molecular Formula | C18H21N4OS+ |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-(4-acetylphenyl)-4-pyridin-1-ium-2-ylpiperazine-1-carbothioamide |
| SMILES | CC(=O)c1ccc(NC(=S)N2CCN(c3cccc[nH+]3)CC2)cc1 |
| InChI | InChI=1S/C18H20N4OS/c1-14(23)15-5-7-16(8-6-15)20-18(24)22-12-10-21(11-13-22)17-4-2-3-9-19-17/h2-9H,10-13H2,1H3,(H,20,24)/p+1 |
| InChIKey | ZOEMIIMJFCBYJA-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 49.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|