C22H29N4O2+ — CID 7341703
(3S)-3-methyl-N-(4-methylphenyl)-5-oxo-5-(4-pyridin-1-ium-2-ylpiperazin-1-yl)pentanamide (PubChem CID 7341703) has the molecular formula C22H29N4O2+ and a molecular weight of 381.50 g/mol. Its IUPAC name is (3S)-3-methyl-N-(4-methylphenyl)-5-oxo-5-(4-pyridin-1-ium-2-ylpiperazin-1-yl)pentanamide.
| Compound Name | (3S)-3-methyl-N-(4-methylphenyl)-5-oxo-5-(4-pyridin-1-ium-2-ylpiperazin-1-yl)pentanamide |
|---|---|
| PubChem CID | 7341703 |
| Molecular Formula | C22H29N4O2+ |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (3S)-3-methyl-N-(4-methylphenyl)-5-oxo-5-(4-pyridin-1-ium-2-ylpiperazin-1-yl)pentanamide |
| SMILES | Cc1ccc(NC(=O)C[C@H](C)CC(=O)N2CCN(c3cccc[nH+]3)CC2)cc1 |
| InChI | InChI=1S/C22H28N4O2/c1-17-6-8-19(9-7-17)24-21(27)15-18(2)16-22(28)26-13-11-25(12-14-26)20-5-3-4-10-23-20/h3-10,18H,11-16H2,1-2H3,(H,24,27)/p+1/t18-/m0/s1 |
| InChIKey | AWXUFRDTNZOQAT-SFHVURJKSA-O |
| XLogP | 2.51 |
| TPSA | 66.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |