C14H30N4OS+2 — CID 7004758
4-methyl-N-(3-morpholin-4-ium-4-ylpropyl)-1,4-diazepan-4-ium-1-carbothioamide (PubChem CID 7004758) has the molecular formula C14H30N4OS+2 and a molecular weight of 302.49 g/mol. Its IUPAC name is 4-methyl-N-(3-morpholin-4-ium-4-ylpropyl)-1,4-diazepan-4-ium-1-carbothioamide.
| Compound Name | 4-methyl-N-(3-morpholin-4-ium-4-ylpropyl)-1,4-diazepan-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 7004758 |
| Molecular Formula | C14H30N4OS+2 |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 4-methyl-N-(3-morpholin-4-ium-4-ylpropyl)-1,4-diazepan-4-ium-1-carbothioamide |
| SMILES | C[NH+]1CCCN(C(=S)NCCC[NH+]2CCOCC2)CC1 |
| InChI | InChI=1S/C14H28N4OS/c1-16-5-3-7-18(9-8-16)14(20)15-4-2-6-17-10-12-19-13-11-17/h2-13H2,1H3,(H,15,20)/p+2 |
| InChIKey | HTVBQTJJTCKZMC-UHFFFAOYSA-P |
| XLogP | -2.61 |
| TPSA | 33.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|