C15H29N4OS+ — CID 9411326
1-(cycloheptylideneamino)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea (PubChem CID 9411326) has the molecular formula C15H29N4OS+ and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-(cycloheptylideneamino)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea.
| Compound Name | 1-(cycloheptylideneamino)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 9411326 |
| Molecular Formula | C15H29N4OS+ |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | 1-(cycloheptylideneamino)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
| SMILES | S=C(NCCC[NH+]1CCOCC1)NN=C1CCCCCC1 |
| InChI | InChI=1S/C15H28N4OS/c21-15(18-17-14-6-3-1-2-4-7-14)16-8-5-9-19-10-12-20-13-11-19/h1-13H2,(H2,16,18,21)/p+1 |
| InChIKey | CLOXOKCEZIJOAS-UHFFFAOYSA-O |
| XLogP | 0.47 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|