C16H23N4O2S+ — CID 8978926
1-[(Z)-2,3-dihydrochromen-4-ylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 8978926) has the molecular formula C16H23N4O2S+ and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[(Z)-2,3-dihydrochromen-4-ylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(Z)-2,3-dihydrochromen-4-ylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 8978926 |
| Molecular Formula | C16H23N4O2S+ |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[(Z)-2,3-dihydrochromen-4-ylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | S=C(NCC[NH+]1CCOCC1)N/N=C1/CCOc2ccccc21 |
| InChI | InChI=1S/C16H22N4O2S/c23-16(17-6-7-20-8-11-21-12-9-20)19-18-14-5-10-22-15-4-2-1-3-13(14)15/h1-4H,5-12H2,(H2,17,19,23)/p+1/b18-14- |
| InChIKey | BPGMPGUQIOOWJG-JXAWBTAJSA-O |
| XLogP | -0.45 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|