C16H20N2O2 — CID 9465772
N-[(Z)-2,3-dihydrochromen-4-ylideneamino]cyclohexanecarboxamide (PubChem CID 9465772) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[(Z)-2,3-dihydrochromen-4-ylideneamino]cyclohexanecarboxamide.
| Compound Name | N-[(Z)-2,3-dihydrochromen-4-ylideneamino]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 9465772 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[(Z)-2,3-dihydrochromen-4-ylideneamino]cyclohexanecarboxamide |
| SMILES | O=C(N/N=C1/CCOc2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C16H20N2O2/c19-16(12-6-2-1-3-7-12)18-17-14-10-11-20-15-9-5-4-8-13(14)15/h4-5,8-9,12H,1-3,6-7,10-11H2,(H,18,19)/b17-14- |
| InChIKey | SXVJJCGRJXAUSI-VKAVYKQESA-N |
| XLogP | 2.87 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|