C10H11N3OS — CID 25234557
[(Z)-2,3-dihydrochromen-4-ylideneamino]thiourea (PubChem CID 25234557) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is [(Z)-2,3-dihydrochromen-4-ylideneamino]thiourea.
| Compound Name | [(Z)-2,3-dihydrochromen-4-ylideneamino]thiourea |
|---|---|
| PubChem CID | 25234557 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | [(Z)-2,3-dihydrochromen-4-ylideneamino]thiourea |
| SMILES | NC(=S)N/N=C1/CCOc2ccccc21 |
| InChI | InChI=1S/C10H11N3OS/c11-10(15)13-12-8-5-6-14-9-4-2-1-3-7(8)9/h1-4H,5-6H2,(H3,11,13,15)/b12-8- |
| InChIKey | BUDGVSJEMNOJIO-WQLSENKSSA-N |
| XLogP | 1.01 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|