C16H14FN3OS — CID 8978703
1-(2,3-dihydrochromen-4-ylideneamino)-3-(2-fluorophenyl)thiourea (PubChem CID 8978703) has the molecular formula C16H14FN3OS and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-(2,3-dihydrochromen-4-ylideneamino)-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-(2,3-dihydrochromen-4-ylideneamino)-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 8978703 |
| Molecular Formula | C16H14FN3OS |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 1-(2,3-dihydrochromen-4-ylideneamino)-3-(2-fluorophenyl)thiourea |
| SMILES | Fc1ccccc1NC(=S)NN=C1CCOc2ccccc21 |
| InChI | InChI=1S/C16H14FN3OS/c17-12-6-2-3-7-14(12)18-16(22)20-19-13-9-10-21-15-8-4-1-5-11(13)15/h1-8H,9-10H2,(H2,18,20,22) |
| InChIKey | FHIBKHWWWJAKEP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|