C19H20FN3O2S — CID 46372057
1-(2-fluorophenyl)-3-[(E)-(6-methoxy-2,2-dimethyl-3H-chromen-4-ylidene)amino]thiourea (PubChem CID 46372057) has the molecular formula C19H20FN3O2S and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[(E)-(6-methoxy-2,2-dimethyl-3H-chromen-4-ylidene)amino]thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-[(E)-(6-methoxy-2,2-dimethyl-3H-chromen-4-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 46372057 |
| Molecular Formula | C19H20FN3O2S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[(E)-(6-methoxy-2,2-dimethyl-3H-chromen-4-ylidene)amino]thiourea |
| SMILES | COc1ccc2c(c1)/C(=N/NC(=S)Nc1ccccc1F)CC(C)(C)O2 |
| InChI | InChI=1S/C19H20FN3O2S/c1-19(2)11-16(13-10-12(24-3)8-9-17(13)25-19)22-23-18(26)21-15-7-5-4-6-14(15)20/h4-10H,11H2,1-3H3,(H2,21,23,26)/b22-16+ |
| InChIKey | GZPWIUKUQOCKLE-CJLVFECKSA-N |
| XLogP | 4.09 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|