C26H31N3O4S — CID 92695929
ethyl 2-[(4Z)-4-[(3-methylphenyl)carbamothioylhydrazinylidene]spiro[3H-chromene-2,1'-cyclohexane]-6-yl]oxyacetate (PubChem CID 92695929) has the molecular formula C26H31N3O4S and a molecular weight of 481.62 g/mol. Its IUPAC name is ethyl 2-[(4Z)-4-[(3-methylphenyl)carbamothioylhydrazinylidene]spiro[3H-chromene-2,1'-cyclohexane]-6-yl]oxyacetate.
| Compound Name | ethyl 2-[(4Z)-4-[(3-methylphenyl)carbamothioylhydrazinylidene]spiro[3H-chromene-2,1'-cyclohexane]-6-yl]oxyacetate |
|---|---|
| PubChem CID | 92695929 |
| Molecular Formula | C26H31N3O4S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | ethyl 2-[(4Z)-4-[(3-methylphenyl)carbamothioylhydrazinylidene]spiro[3H-chromene-2,1'-cyclohexane]-6-yl]oxyacetate |
| SMILES | CCOC(=O)COc1ccc2c(c1)/C(=N\NC(=S)Nc1cccc(C)c1)CC1(CCCCC1)O2 |
| InChI | InChI=1S/C26H31N3O4S/c1-3-31-24(30)17-32-20-10-11-23-21(15-20)22(16-26(33-23)12-5-4-6-13-26)28-29-25(34)27-19-9-7-8-18(2)14-19/h7-11,14-15H,3-6,12-13,16-17H2,1-2H3,(H2,27,29,34)/b28-22- |
| InChIKey | AAKBERSVJFEUQQ-SLMZUGIISA-N |
| XLogP | 5.11 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|