C27H28N4O5S — CID 46372310
ethyl 2-[[(4E)-4-[(3-methoxyphenyl)carbamothioylhydrazinylidene]-2-methyl-2-pyridin-3-yl-3H-chromen-6-yl]oxy]acetate (PubChem CID 46372310) has the molecular formula C27H28N4O5S and a molecular weight of 520.61 g/mol. Its IUPAC name is ethyl 2-[[(4E)-4-[(3-methoxyphenyl)carbamothioylhydrazinylidene]-2-methyl-2-pyridin-3-yl-3H-chromen-6-yl]oxy]acetate.
| Compound Name | ethyl 2-[[(4E)-4-[(3-methoxyphenyl)carbamothioylhydrazinylidene]-2-methyl-2-pyridin-3-yl-3H-chromen-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 46372310 |
| Molecular Formula | C27H28N4O5S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | ethyl 2-[[(4E)-4-[(3-methoxyphenyl)carbamothioylhydrazinylidene]-2-methyl-2-pyridin-3-yl-3H-chromen-6-yl]oxy]acetate |
| SMILES | CCOC(=O)COc1ccc2c(c1)/C(=N/NC(=S)Nc1cccc(OC)c1)CC(C)(c1cccnc1)O2 |
| InChI | InChI=1S/C27H28N4O5S/c1-4-34-25(32)17-35-21-10-11-24-22(14-21)23(15-27(2,36-24)18-7-6-12-28-16-18)30-31-26(37)29-19-8-5-9-20(13-19)33-3/h5-14,16H,4,15,17H2,1-3H3,(H2,29,31,37)/b30-23+ |
| InChIKey | FAGLSKAXVRAOBX-JJKYIXSRSA-N |
| XLogP | 4.42 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|