C12H16N2O3S — CID 2211509
ethyl 2-[(3-methoxyphenyl)carbamothioylamino]acetate (PubChem CID 2211509) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is ethyl 2-[(3-methoxyphenyl)carbamothioylamino]acetate.
| Compound Name | ethyl 2-[(3-methoxyphenyl)carbamothioylamino]acetate |
|---|---|
| PubChem CID | 2211509 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | ethyl 2-[(3-methoxyphenyl)carbamothioylamino]acetate |
| SMILES | CCOC(=O)CNC(=S)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C12H16N2O3S/c1-3-17-11(15)8-13-12(18)14-9-5-4-6-10(7-9)16-2/h4-7H,3,8H2,1-2H3,(H2,13,14,18) |
| InChIKey | ZGCSLYHAOAXFAA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|