C26H30ClN3O4S — CID 5005162
ethyl 2-[4-[2-[(3-chloro-4-methylphenyl)carbamothioyl]hydrazinyl]spiro[chromene-2,1'-cyclohexane]-6-yl]oxyacetate (PubChem CID 5005162) has the molecular formula C26H30ClN3O4S and a molecular weight of 516.06 g/mol. Its IUPAC name is ethyl 2-[4-[2-[(3-chloro-4-methylphenyl)carbamothioyl]hydrazinyl]spiro[chromene-2,1'-cyclohexane]-6-yl]oxyacetate.
| Compound Name | ethyl 2-[4-[2-[(3-chloro-4-methylphenyl)carbamothioyl]hydrazinyl]spiro[chromene-2,1'-cyclohexane]-6-yl]oxyacetate |
|---|---|
| PubChem CID | 5005162 |
| Molecular Formula | C26H30ClN3O4S |
| Molecular Weight | 516.06 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | ethyl 2-[4-[2-[(3-chloro-4-methylphenyl)carbamothioyl]hydrazinyl]spiro[chromene-2,1'-cyclohexane]-6-yl]oxyacetate |
| SMILES | CCOC(=O)COc1ccc2c(c1)C(NNC(=S)Nc1ccc(C)c(Cl)c1)=CC1(CCCCC1)O2 |
| InChI | InChI=1S/C26H30ClN3O4S/c1-3-32-24(31)16-33-19-9-10-23-20(14-19)22(15-26(34-23)11-5-4-6-12-26)29-30-25(35)28-18-8-7-17(2)21(27)13-18/h7-10,13-15,29H,3-6,11-12,16H2,1-2H3,(H2,28,30,35) |
| InChIKey | KOQPHAVVKZCFOC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.06 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|