C19H21N3S — CID 7933475
1-(2-methylphenyl)-3-[(E)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]thiourea (PubChem CID 7933475) has the molecular formula C19H21N3S and a molecular weight of 323.47 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[(E)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]thiourea.
| Compound Name | 1-(2-methylphenyl)-3-[(E)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]thiourea |
|---|---|
| PubChem CID | 7933475 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-(2-methylphenyl)-3-[(E)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]thiourea |
| SMILES | Cc1ccccc1NC(=S)N/N=C1\CCCCc2ccccc21 |
| InChI | InChI=1S/C19H21N3S/c1-14-8-2-6-12-17(14)20-19(23)22-21-18-13-7-4-10-15-9-3-5-11-16(15)18/h2-3,5-6,8-9,11-12H,4,7,10,13H2,1H3,(H2,20,22,23)/b21-18+ |
| InChIKey | VKUYVWCEQPOXEO-DYTRJAOYSA-N |
| XLogP | 4.41 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|