C20H22N2O — CID 6525291
2,4-dimethyl-N-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]benzamide (PubChem CID 6525291) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]benzamide.
| Compound Name | 2,4-dimethyl-N-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]benzamide |
|---|---|
| PubChem CID | 6525291 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2,4-dimethyl-N-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]benzamide |
| SMILES | Cc1ccc(C(=O)N/N=C2/CCCCc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C20H22N2O/c1-14-11-12-17(15(2)13-14)20(23)22-21-19-10-6-4-8-16-7-3-5-9-18(16)19/h3,5,7,9,11-13H,4,6,8,10H2,1-2H3,(H,22,23)/b21-19- |
| InChIKey | IOLZUSGEGLZNQY-VZCXRCSSSA-N |
| XLogP | 4.16 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|