C26H24N4O3 — CID 3419131
2-N,5-N-bis(3,4-dihydro-2H-naphthalen-1-ylideneamino)furan-2,5-dicarboxamide (PubChem CID 3419131) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-N,5-N-bis(3,4-dihydro-2H-naphthalen-1-ylideneamino)furan-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis(3,4-dihydro-2H-naphthalen-1-ylideneamino)furan-2,5-dicarboxamide |
|---|---|
| PubChem CID | 3419131 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2-N,5-N-bis(3,4-dihydro-2H-naphthalen-1-ylideneamino)furan-2,5-dicarboxamide |
| SMILES | O=C(NN=C1CCCc2ccccc21)c1ccc(C(=O)NN=C2CCCc3ccccc32)o1 |
| InChI | InChI=1S/C26H24N4O3/c31-25(29-27-21-13-5-9-17-7-1-3-11-19(17)21)23-15-16-24(33-23)26(32)30-28-22-14-6-10-18-8-2-4-12-20(18)22/h1-4,7-8,11-12,15-16H,5-6,9-10,13-14H2,(H,29,31)(H,30,32) |
| InChIKey | RBKHJKJPOVDEEQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|