C19H17N3O — CID 840700
N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1H-indole-3-carboxamide (PubChem CID 840700) has the molecular formula C19H17N3O and a molecular weight of 303.37 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1H-indole-3-carboxamide.
| Compound Name | N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 840700 |
| Molecular Formula | C19H17N3O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1H-indole-3-carboxamide |
| SMILES | O=C(NN=C1CCCc2ccccc21)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17N3O/c23-19(16-12-20-17-10-4-3-9-15(16)17)22-21-18-11-5-7-13-6-1-2-8-14(13)18/h1-4,6,8-10,12,20H,5,7,11H2,(H,22,23) |
| InChIKey | LQDPLSSLDPCZAU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|