C18H23N3O — CID 5142375
N-[(4-propylcyclohexylidene)amino]-1H-indole-3-carboxamide (PubChem CID 5142375) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[(4-propylcyclohexylidene)amino]-1H-indole-3-carboxamide.
| Compound Name | N-[(4-propylcyclohexylidene)amino]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 5142375 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-[(4-propylcyclohexylidene)amino]-1H-indole-3-carboxamide |
| SMILES | CCCC1CCC(=NNC(=O)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C18H23N3O/c1-2-5-13-8-10-14(11-9-13)20-21-18(22)16-12-19-17-7-4-3-6-15(16)17/h3-4,6-7,12-13,19H,2,5,8-11H2,1H3,(H,21,22)/b20-14- |
| InChIKey | BMNFNAQXKBYDCT-ZHZULCJRSA-N |
| XLogP | 4.24 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|