C16H14N2O2 — CID 6517128
N-[(Z)-2,3-dihydroinden-1-ylideneamino]-4-hydroxybenzamide (PubChem CID 6517128) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-[(Z)-2,3-dihydroinden-1-ylideneamino]-4-hydroxybenzamide.
| Compound Name | N-[(Z)-2,3-dihydroinden-1-ylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 6517128 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-[(Z)-2,3-dihydroinden-1-ylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(N/N=C1/CCc2ccccc21)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H14N2O2/c19-13-8-5-12(6-9-13)16(20)18-17-15-10-7-11-3-1-2-4-14(11)15/h1-6,8-9,19H,7,10H2,(H,18,20)/b17-15- |
| InChIKey | GGWJWAOBDVZNFO-ICFOKQHNSA-N |
| XLogP | 2.47 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|