C16H15N3O — CID 6520422
4-amino-N-[(Z)-2,3-dihydroinden-1-ylideneamino]benzamide (PubChem CID 6520422) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 4-amino-N-[(Z)-2,3-dihydroinden-1-ylideneamino]benzamide.
| Compound Name | 4-amino-N-[(Z)-2,3-dihydroinden-1-ylideneamino]benzamide |
|---|---|
| PubChem CID | 6520422 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 4-amino-N-[(Z)-2,3-dihydroinden-1-ylideneamino]benzamide |
| SMILES | Nc1ccc(C(=O)N/N=C2/CCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H15N3O/c17-13-8-5-12(6-9-13)16(20)19-18-15-10-7-11-3-1-2-4-14(11)15/h1-6,8-9H,7,10,17H2,(H,19,20)/b18-15- |
| InChIKey | VNWHZONNGRDHLH-SDXDJHTJSA-N |
| XLogP | 2.35 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|