C19H19BrN2O3 — CID 9466659
3-bromo-N-[(Z)-2,3-dihydroinden-1-ylideneamino]-4-ethoxy-5-methoxybenzamide (PubChem CID 9466659) has the molecular formula C19H19BrN2O3 and a molecular weight of 403.28 g/mol. Its IUPAC name is 3-bromo-N-[(Z)-2,3-dihydroinden-1-ylideneamino]-4-ethoxy-5-methoxybenzamide.
| Compound Name | 3-bromo-N-[(Z)-2,3-dihydroinden-1-ylideneamino]-4-ethoxy-5-methoxybenzamide |
|---|---|
| PubChem CID | 9466659 |
| Molecular Formula | C19H19BrN2O3 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 3-bromo-N-[(Z)-2,3-dihydroinden-1-ylideneamino]-4-ethoxy-5-methoxybenzamide |
| SMILES | CCOc1c(Br)cc(C(=O)N/N=C2/CCc3ccccc32)cc1OC |
| InChI | InChI=1S/C19H19BrN2O3/c1-3-25-18-15(20)10-13(11-17(18)24-2)19(23)22-21-16-9-8-12-6-4-5-7-14(12)16/h4-7,10-11H,3,8-9H2,1-2H3,(H,22,23)/b21-16- |
| InChIKey | LXBNYQASQBIXPR-PGMHBOJBSA-N |
| XLogP | 3.94 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|