C24H25N3O — CID 6529503
2,5-dimethyl-1-phenyl-N-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]pyrrole-3-carboxamide (PubChem CID 6529503) has the molecular formula C24H25N3O and a molecular weight of 371.48 g/mol. Its IUPAC name is 2,5-dimethyl-1-phenyl-N-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-1-phenyl-N-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 6529503 |
| Molecular Formula | C24H25N3O |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 2,5-dimethyl-1-phenyl-N-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C2/CCCCc3ccccc32)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C24H25N3O/c1-17-16-22(18(2)27(17)20-12-4-3-5-13-20)24(28)26-25-23-15-9-7-11-19-10-6-8-14-21(19)23/h3-6,8,10,12-14,16H,7,9,11,15H2,1-2H3,(H,26,28)/b25-23- |
| InChIKey | HFSZHYYPJBHGKH-BZZOAKBMSA-N |
| XLogP | 4.95 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|