C16H22N2O — CID 7858354
2,4-dimethyl-N-[(Z)-[(3R)-3-methylcyclohexylidene]amino]benzamide (PubChem CID 7858354) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(Z)-[(3R)-3-methylcyclohexylidene]amino]benzamide.
| Compound Name | 2,4-dimethyl-N-[(Z)-[(3R)-3-methylcyclohexylidene]amino]benzamide |
|---|---|
| PubChem CID | 7858354 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2,4-dimethyl-N-[(Z)-[(3R)-3-methylcyclohexylidene]amino]benzamide |
| SMILES | Cc1ccc(C(=O)N/N=C2/CCC[C@@H](C)C2)c(C)c1 |
| InChI | InChI=1S/C16H22N2O/c1-11-5-4-6-14(10-11)17-18-16(19)15-8-7-12(2)9-13(15)3/h7-9,11H,4-6,10H2,1-3H3,(H,18,19)/b17-14-/t11-/m1/s1 |
| InChIKey | WTPFBQYYNDEFAC-YOEHMKRZSA-N |
| XLogP | 3.60 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|