C12H18N4O — CID 17384885
5-methyl-N-[(Z)-(3-methylcyclohexylidene)amino]-1H-pyrazole-3-carboxamide (PubChem CID 17384885) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 5-methyl-N-[(Z)-(3-methylcyclohexylidene)amino]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-methyl-N-[(Z)-(3-methylcyclohexylidene)amino]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 17384885 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 5-methyl-N-[(Z)-(3-methylcyclohexylidene)amino]-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C2/CCCC(C)C2)n[nH]1 |
| InChI | InChI=1S/C12H18N4O/c1-8-4-3-5-10(6-8)14-16-12(17)11-7-9(2)13-15-11/h7-8H,3-6H2,1-2H3,(H,13,15)(H,16,17)/b14-10- |
| InChIKey | JIPQXCSFBOAAMS-UVTDQMKNSA-N |
| XLogP | 2.01 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|