C13H18N4O2 — CID 7278032
N-[(Z)-(3,3-dimethyl-5-oxocyclohexylidene)amino]-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 7278032) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-[(Z)-(3,3-dimethyl-5-oxocyclohexylidene)amino]-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(Z)-(3,3-dimethyl-5-oxocyclohexylidene)amino]-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 7278032 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-[(Z)-(3,3-dimethyl-5-oxocyclohexylidene)amino]-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C2\CC(=O)CC(C)(C)C2)n[nH]1 |
| InChI | InChI=1S/C13H18N4O2/c1-8-4-11(16-14-8)12(19)17-15-9-5-10(18)7-13(2,3)6-9/h4H,5-7H2,1-3H3,(H,14,16)(H,17,19)/b15-9+ |
| InChIKey | VTUWAQJCENPLAI-OQLLNIDSSA-N |
| XLogP | 1.58 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|