C11H18N4O — CID 5411186
N-[(E)-3,3-dimethylbutan-2-ylideneamino]-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 5411186) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is N-[(E)-3,3-dimethylbutan-2-ylideneamino]-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(E)-3,3-dimethylbutan-2-ylideneamino]-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 5411186 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N-[(E)-3,3-dimethylbutan-2-ylideneamino]-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | C/C(=N\NC(=O)c1cc(C)[nH]n1)C(C)(C)C |
| InChI | InChI=1S/C11H18N4O/c1-7-6-9(14-12-7)10(16)15-13-8(2)11(3,4)5/h6H,1-5H3,(H,12,14)(H,15,16)/b13-8+ |
| InChIKey | RRCQXKXYASCIBU-MDWZMJQESA-N |
| XLogP | 1.87 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|