C16H22N8O4 — CID 3689609
1-N',6-N'-bis(5-methyl-1H-pyrazole-3-carbonyl)hexanedihydrazide (PubChem CID 3689609) has the molecular formula C16H22N8O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is 1-N',6-N'-bis(5-methyl-1H-pyrazole-3-carbonyl)hexanedihydrazide.
| Compound Name | 1-N',6-N'-bis(5-methyl-1H-pyrazole-3-carbonyl)hexanedihydrazide |
|---|---|
| PubChem CID | 3689609 |
| Molecular Formula | C16H22N8O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-N',6-N'-bis(5-methyl-1H-pyrazole-3-carbonyl)hexanedihydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)CCCCC(=O)NNC(=O)c2cc(C)[nH]n2)n[nH]1 |
| InChI | InChI=1S/C16H22N8O4/c1-9-7-11(19-17-9)15(27)23-21-13(25)5-3-4-6-14(26)22-24-16(28)12-8-10(2)18-20-12/h7-8H,3-6H2,1-2H3,(H,17,19)(H,18,20)(H,21,25)(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | PNPKTABRPYDDGB-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 173.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|