C11H17N5O — CID 2315324
5-methyl-N'-(3,4,5,6-tetrahydro-2H-azepin-7-yl)-1H-pyrazole-3-carbohydrazide (PubChem CID 2315324) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 5-methyl-N'-(3,4,5,6-tetrahydro-2H-azepin-7-yl)-1H-pyrazole-3-carbohydrazide.
| Compound Name | 5-methyl-N'-(3,4,5,6-tetrahydro-2H-azepin-7-yl)-1H-pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 2315324 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 5-methyl-N'-(3,4,5,6-tetrahydro-2H-azepin-7-yl)-1H-pyrazole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC2=NCCCCC2)n[nH]1 |
| InChI | InChI=1S/C11H17N5O/c1-8-7-9(14-13-8)11(17)16-15-10-5-3-2-4-6-12-10/h7H,2-6H2,1H3,(H,12,15)(H,13,14)(H,16,17) |
| InChIKey | DQTGBWSDUNKHOM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|