C18H19N3S — CID 7930495
1-[(Z)-2,3-dihydroinden-1-ylideneamino]-3-(2,6-dimethylphenyl)thiourea (PubChem CID 7930495) has the molecular formula C18H19N3S and a molecular weight of 309.44 g/mol. Its IUPAC name is 1-[(Z)-2,3-dihydroinden-1-ylideneamino]-3-(2,6-dimethylphenyl)thiourea.
| Compound Name | 1-[(Z)-2,3-dihydroinden-1-ylideneamino]-3-(2,6-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 7930495 |
| Molecular Formula | C18H19N3S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-[(Z)-2,3-dihydroinden-1-ylideneamino]-3-(2,6-dimethylphenyl)thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)N/N=C1/CCc2ccccc21 |
| InChI | InChI=1S/C18H19N3S/c1-12-6-5-7-13(2)17(12)19-18(22)21-20-16-11-10-14-8-3-4-9-15(14)16/h3-9H,10-11H2,1-2H3,(H2,19,21,22)/b20-16- |
| InChIKey | BUUIQYXLKIJOJV-SILNSSARSA-N |
| XLogP | 3.94 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|