C19H29N3S — CID 7930486
1-[(4-tert-butylcyclohexylidene)amino]-3-(2,6-dimethylphenyl)thiourea (PubChem CID 7930486) has the molecular formula C19H29N3S and a molecular weight of 331.53 g/mol. Its IUPAC name is 1-[(4-tert-butylcyclohexylidene)amino]-3-(2,6-dimethylphenyl)thiourea.
| Compound Name | 1-[(4-tert-butylcyclohexylidene)amino]-3-(2,6-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 7930486 |
| Molecular Formula | C19H29N3S |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 1-[(4-tert-butylcyclohexylidene)amino]-3-(2,6-dimethylphenyl)thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)NN=C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H29N3S/c1-13-7-6-8-14(2)17(13)20-18(23)22-21-16-11-9-15(10-12-16)19(3,4)5/h6-8,15H,9-12H2,1-5H3,(H2,20,22,23)/b21-16- |
| InChIKey | NQOSWOKGBSDIBD-PGMHBOJBSA-N |
| XLogP | 5.18 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|