C16H16N4S — CID 6512939
1-[(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-3-pyridin-3-ylthiourea (PubChem CID 6512939) has the molecular formula C16H16N4S and a molecular weight of 296.40 g/mol. Its IUPAC name is 1-[(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 6512939 |
| Molecular Formula | C16H16N4S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-[(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-3-pyridin-3-ylthiourea |
| SMILES | S=C(N/N=C1/CCCc2ccccc21)Nc1cccnc1 |
| InChI | InChI=1S/C16H16N4S/c21-16(18-13-7-4-10-17-11-13)20-19-15-9-3-6-12-5-1-2-8-14(12)15/h1-2,4-5,7-8,10-11H,3,6,9H2,(H2,18,20,21)/b19-15- |
| InChIKey | IUJWFZXSJWKZGC-CYVLTUHYSA-N |
| XLogP | 3.11 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|