C15H14N4O — CID 168874969
N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]pyridine-3-carboxamide (PubChem CID 168874969) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 168874969 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(N/N=C1\CCCc2cccnc21)c1cccnc1 |
| InChI | InChI=1S/C15H14N4O/c20-15(12-6-2-8-16-10-12)19-18-13-7-1-4-11-5-3-9-17-14(11)13/h2-3,5-6,8-10H,1,4,7H2,(H,19,20)/b18-13+ |
| InChIKey | DXUCBDZYOQNOKN-QGOAFFKASA-N |
| XLogP | 1.95 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|