C22H20N4O3 — CID 19158498
N-[(E)-[3-methyl-2-(phenylcarbamoyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide (PubChem CID 19158498) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is N-[(E)-[3-methyl-2-(phenylcarbamoyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide.
| Compound Name | N-[(E)-[3-methyl-2-(phenylcarbamoyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 19158498 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-[(E)-[3-methyl-2-(phenylcarbamoyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2)oc2c1/C(=N/NC(=O)c1cccnc1)CCC2 |
| InChI | InChI=1S/C22H20N4O3/c1-14-19-17(25-26-21(27)15-7-6-12-23-13-15)10-5-11-18(19)29-20(14)22(28)24-16-8-3-2-4-9-16/h2-4,6-9,12-13H,5,10-11H2,1H3,(H,24,28)(H,26,27)/b25-17+ |
| InChIKey | VJXONTNHSWNJQJ-KOEQRZSOSA-N |
| XLogP | 3.71 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|