C28H23BrN6O3 — CID 19160840
5-bromo-N-[(E)-[3-methyl-2-[(4-phenyldiazenylphenyl)carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide (PubChem CID 19160840) has the molecular formula C28H23BrN6O3 and a molecular weight of 571.44 g/mol. Its IUPAC name is 5-bromo-N-[(E)-[3-methyl-2-[(4-phenyldiazenylphenyl)carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[(E)-[3-methyl-2-[(4-phenyldiazenylphenyl)carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 19160840 |
| Molecular Formula | C28H23BrN6O3 |
| Molecular Weight | 571.44 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | 5-bromo-N-[(E)-[3-methyl-2-[(4-phenyldiazenylphenyl)carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(/N=N/c3ccccc3)cc2)oc2c1/C(=N/NC(=O)c1cncc(Br)c1)CCC2 |
| InChI | InChI=1S/C28H23BrN6O3/c1-17-25-23(34-35-27(36)18-14-19(29)16-30-15-18)8-5-9-24(25)38-26(17)28(37)31-20-10-12-22(13-11-20)33-32-21-6-3-2-4-7-21/h2-4,6-7,10-16H,5,8-9H2,1H3,(H,31,37)(H,35,36)/b33-32+,34-23+ |
| InChIKey | QEXMQZBYCGBCAP-MUQSKDQNSA-N |
| XLogP | 6.88 |
| TPSA | 121.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.44 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|