C22H18BrN3O4 — CID 19160896
phenyl (4E)-4-[(5-bromopyridine-3-carbonyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19160896) has the molecular formula C22H18BrN3O4 and a molecular weight of 468.31 g/mol. Its IUPAC name is phenyl (4E)-4-[(5-bromopyridine-3-carbonyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | phenyl (4E)-4-[(5-bromopyridine-3-carbonyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19160896 |
| Molecular Formula | C22H18BrN3O4 |
| Molecular Weight | 468.31 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | phenyl (4E)-4-[(5-bromopyridine-3-carbonyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)Oc2ccccc2)oc2c1/C(=N/NC(=O)c1cncc(Br)c1)CCC2 |
| InChI | InChI=1S/C22H18BrN3O4/c1-13-19-17(25-26-21(27)14-10-15(23)12-24-11-14)8-5-9-18(19)30-20(13)22(28)29-16-6-3-2-4-7-16/h2-4,6-7,10-12H,5,8-9H2,1H3,(H,26,27)/b25-17+ |
| InChIKey | IVXPYFUMRGQNDN-KOEQRZSOSA-N |
| XLogP | 4.44 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|