C29H22N4O4 — CID 19158516
[4-(4-cyanophenyl)phenyl] (4E)-3-methyl-4-(pyridine-3-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19158516) has the molecular formula C29H22N4O4 and a molecular weight of 490.52 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] (4E)-3-methyl-4-(pyridine-3-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | [4-(4-cyanophenyl)phenyl] (4E)-3-methyl-4-(pyridine-3-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19158516 |
| Molecular Formula | C29H22N4O4 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] (4E)-3-methyl-4-(pyridine-3-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)Oc2ccc(-c3ccc(C#N)cc3)cc2)oc2c1/C(=N/NC(=O)c1cccnc1)CCC2 |
| InChI | InChI=1S/C29H22N4O4/c1-18-26-24(32-33-28(34)22-4-3-15-31-17-22)5-2-6-25(26)37-27(18)29(35)36-23-13-11-21(12-14-23)20-9-7-19(16-30)8-10-20/h3-4,7-15,17H,2,5-6H2,1H3,(H,33,34)/b32-24+ |
| InChIKey | WVMKERACAGPPHO-FEZSWGLMSA-N |
| XLogP | 5.21 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|